C24H33NO4Si — CID 155658340
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)piperidine-1-carboxylic acid (PubChem CID 155658340) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)piperidine-1-carboxylic acid.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155658340 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](OCC1CC(CO)CCN1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO4Si/c1-24(2,3)30(21-10-6-4-7-11-21,22-12-8-5-9-13-22)29-18-20-16-19(17-26)14-15-25(20)23(27)28/h4-13,19-20,26H,14-18H2,1-3H3,(H,27,28) |
| InChIKey | ANSKWQFBTUARAG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|