C28H42N2O3Si — CID 139939732
tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(dimethylamino)pyrrolidine-1-carboxylate (PubChem CID 139939732) has the molecular formula C28H42N2O3Si and a molecular weight of 482.74 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(dimethylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(dimethylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139939732 |
| Molecular Formula | C28H42N2O3Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | tert-butyl (2R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(dimethylamino)pyrrolidine-1-carboxylate |
| SMILES | CN(C)[C@@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H42N2O3Si/c1-27(2,3)33-26(31)30-20-22(29(7)8)19-23(30)21-32-34(28(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,22-23H,19-21H2,1-8H3/t22-,23-/m1/s1 |
| InChIKey | MBEBGFPBNJWSRS-DHIUTWEWSA-N |
| XLogP | 4.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|