C27H39NO3Si — CID 175712806
tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-1-carboxylate (PubChem CID 175712806) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175712806 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H39NO3Si/c1-26(2,3)31-25(29)28-20-14-13-15-22(28)21-30-32(27(4,5)6,23-16-9-7-10-17-23)24-18-11-8-12-19-24/h7-12,16-19,22H,13-15,20-21H2,1-6H3 |
| InChIKey | RGJLYZDKYARAGZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|