C31H37NO3Si — CID 59396023
benzyl (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 59396023) has the molecular formula C31H37NO3Si and a molecular weight of 499.73 g/mol. Its IUPAC name is benzyl (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | benzyl (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 59396023 |
| Molecular Formula | C31H37NO3Si |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | benzyl (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H]2C[C@@H]2CN1C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37NO3Si/c1-31(2,3)36(28-15-9-5-10-16-28,29-17-11-6-12-18-29)35-23-27-20-25-19-26(25)21-32(27)30(33)34-22-24-13-7-4-8-14-24/h4-18,25-27H,19-23H2,1-3H3/t25-,26+,27-/m0/s1 |
| InChIKey | UVXCXBVIKRVOAF-VJGNERBWSA-N |
| XLogP | 5.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|