C29H35NO4Si — CID 10719847
benzyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 10719847) has the molecular formula C29H35NO4Si and a molecular weight of 489.69 g/mol. Its IUPAC name is benzyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10719847 |
| Molecular Formula | C29H35NO4Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | benzyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](O[C@H]1CCN(C(=O)OCc2ccccc2)[C@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO4Si/c1-29(2,3)35(24-15-9-5-10-16-24,25-17-11-6-12-18-25)34-27-19-20-30(26(27)21-31)28(32)33-22-23-13-7-4-8-14-23/h4-18,26-27,31H,19-22H2,1-3H3/t26-,27-/m0/s1 |
| InChIKey | PAJMOYIHLVRZGF-SVBPBHIXSA-N |
| XLogP | 4.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|