C31H38N2O5Si — CID 142683565
benzyl (2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 142683565) has the molecular formula C31H38N2O5Si and a molecular weight of 546.74 g/mol. Its IUPAC name is benzyl (2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142683565 |
| Molecular Formula | C31H38N2O5Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | benzyl (2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(methoxymethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | COCNC(=O)[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H38N2O5Si/c1-31(2,3)39(26-16-10-6-11-17-26,27-18-12-7-13-19-27)38-25-20-28(29(34)32-23-36-4)33(21-25)30(35)37-22-24-14-8-5-9-15-24/h5-19,25,28H,20-23H2,1-4H3,(H,32,34)/t25-,28-/m1/s1 |
| InChIKey | OEVFFKFALXFCPT-LEAFIULHSA-N |
| XLogP | 4.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|