C25H33NO5Si — CID 24787516
dimethyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxypiperidine-1,2-dicarboxylate (PubChem CID 24787516) has the molecular formula C25H33NO5Si and a molecular weight of 455.63 g/mol. Its IUPAC name is dimethyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxypiperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 24787516 |
| Molecular Formula | C25H33NO5Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | dimethyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1C(=O)OC |
| InChI | InChI=1S/C25H33NO5Si/c1-25(2,3)32(20-12-8-6-9-13-20,21-14-10-7-11-15-21)31-19-16-17-26(24(28)30-5)22(18-19)23(27)29-4/h6-15,19,22H,16-18H2,1-5H3/t19-,22+/m1/s1 |
| InChIKey | WUQNEDIDGALUFW-KNQAVFIVSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|