C40H50O4Si2 — CID 21062599
methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]cyclohexane-1-carboxylate (PubChem CID 21062599) has the molecular formula C40H50O4Si2 and a molecular weight of 651.01 g/mol. Its IUPAC name is methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21062599 |
| Molecular Formula | C40H50O4Si2 |
| Molecular Weight | 651.01 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | methyl 3,5-bis[[tert-butyl(diphenyl)silyl]oxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C40H50O4Si2/c1-39(2,3)45(34-20-12-8-13-21-34,35-22-14-9-15-23-35)43-32-28-31(38(41)42-7)29-33(30-32)44-46(40(4,5)6,36-24-16-10-17-25-36)37-26-18-11-19-27-37/h8-27,31-33H,28-30H2,1-7H3 |
| InChIKey | YIEQRXSCADQJFV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.01 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|