C20H25BrOSi — CID 142577121
(3-bromocyclobutyl)oxy-tert-butyl-diphenylsilane (PubChem CID 142577121) has the molecular formula C20H25BrOSi and a molecular weight of 389.41 g/mol. Its IUPAC name is (3-bromocyclobutyl)oxy-tert-butyl-diphenylsilane.
| Compound Name | (3-bromocyclobutyl)oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 142577121 |
| Molecular Formula | C20H25BrOSi |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (3-bromocyclobutyl)oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1CC(Br)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25BrOSi/c1-20(2,3)23(18-10-6-4-7-11-18,19-12-8-5-9-13-19)22-17-14-16(21)15-17/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | LADNHVMEJDUDQP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|