C21H26OSi — CID 11347853
tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane (PubChem CID 11347853) has the molecular formula C21H26OSi and a molecular weight of 322.52 g/mol. Its IUPAC name is tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane.
| Compound Name | tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane |
|---|---|
| PubChem CID | 11347853 |
| Molecular Formula | C21H26OSi |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl-cyclopent-3-en-1-yloxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1CC=CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26OSi/c1-21(2,3)23(19-14-6-4-7-15-19,20-16-8-5-9-17-20)22-18-12-10-11-13-18/h4-11,14-18H,12-13H2,1-3H3 |
| InChIKey | GCODZQWZNXYLIA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|