C20H25NO2Si — CID 15427815
tert-butyl-[[(3R)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-diphenylsilane (PubChem CID 15427815) has the molecular formula C20H25NO2Si and a molecular weight of 339.51 g/mol. Its IUPAC name is tert-butyl-[[(3R)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(3R)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 15427815 |
| Molecular Formula | C20H25NO2Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl-[[(3R)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC=[N+]([O-])C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2Si/c1-20(2,3)24(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-17-14-15-21(22)16-17/h4-13,15,17H,14,16H2,1-3H3/t17-/m1/s1 |
| InChIKey | TVUOQKIMHJTZCX-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|