C42H58N2O4Si2 — CID 159197453
4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diamine;4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diol (PubChem CID 159197453) has the molecular formula C42H58N2O4Si2 and a molecular weight of 711.11 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diamine;4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diol.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diamine;4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diol |
|---|---|
| PubChem CID | 159197453 |
| Molecular Formula | C42H58N2O4Si2 |
| Molecular Weight | 711.11 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diamine;4-[tert-butyl(diphenyl)silyl]oxycyclopentane-1,2-diol |
| SMILES | CC(C)(C)[Si](OC1CC(N)C(N)C1)(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OC1CC(O)C(O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2OSi.C21H28O3Si/c2*1-21(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-16-14-19(22)20(23)15-16/h4-13,16,19-20H,14-15,22-23H2,1-3H3;4-13,16,19-20,22-23H,14-15H2,1-3H3 |
| InChIKey | KOVQPWHPIRJEFT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.11 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|