C26H33Cl3O3Si — CID 101261117
(1R,2R,3aR,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(1R)-2,2,2-trichloro-1-hydroxyethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 101261117) has the molecular formula C26H33Cl3O3Si and a molecular weight of 527.99 g/mol. Its IUPAC name is (1R,2R,3aR,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(1R)-2,2,2-trichloro-1-hydroxyethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (1R,2R,3aR,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(1R)-2,2,2-trichloro-1-hydroxyethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 101261117 |
| Molecular Formula | C26H33Cl3O3Si |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (1R,2R,3aR,5S,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(1R)-2,2,2-trichloro-1-hydroxyethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1C[C@H]2C[C@@H](O)[C@H]([C@@H](O)C(Cl)(Cl)Cl)[C@H]2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33Cl3O3Si/c1-25(2,3)33(19-10-6-4-7-11-19,20-12-8-5-9-13-20)32-18-14-17-15-22(30)23(21(17)16-18)24(31)26(27,28)29/h4-13,17-18,21-24,30-31H,14-16H2,1-3H3/t17-,18-,21-,22+,23+,24+/m0/s1 |
| InChIKey | HMGXSOPSXFOTGO-GBLDUXDFSA-N |
| XLogP | 5.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|