C24H30O2Si — CID 129323384
1-[(1R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-6-bicyclo[3.1.0]hexanyl]ethanone (PubChem CID 129323384) has the molecular formula C24H30O2Si and a molecular weight of 378.59 g/mol. Its IUPAC name is 1-[(1R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-6-bicyclo[3.1.0]hexanyl]ethanone.
| Compound Name | 1-[(1R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-6-bicyclo[3.1.0]hexanyl]ethanone |
|---|---|
| PubChem CID | 129323384 |
| Molecular Formula | C24H30O2Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-[(1R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-6-bicyclo[3.1.0]hexanyl]ethanone |
| SMILES | CC(=O)C1[C@@H]2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C24H30O2Si/c1-17(25)23-21-15-18(16-22(21)23)26-27(24(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21-23H,15-16H2,1-4H3/t18?,21-,22-,23?/m1/s1 |
| InChIKey | KVOLWBLSZRFUOH-HPYQEZSOSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|