C27H36O5Si — CID 10863628
[(1S,3S,4S,5R)-3-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylcyclohexyl] acetate (PubChem CID 10863628) has the molecular formula C27H36O5Si and a molecular weight of 468.67 g/mol. Its IUPAC name is [(1S,3S,4S,5R)-3-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,3S,4S,5R)-3-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 10863628 |
| Molecular Formula | C27H36O5Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [(1S,3S,4S,5R)-3-acetyloxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](OC(C)=O)[C@H](C)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C27H36O5Si/c1-19-25(31-21(3)29)17-22(30-20(2)28)18-26(19)32-33(27(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,19,22,25-26H,17-18H2,1-6H3/t19-,22-,25-,26+/m0/s1 |
| InChIKey | WEMPGGXCZMNFLO-FBESYSLLSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|