C23H30O3Si — CID 153312960
(2R)-2-[tert-butyl(diphenyl)silyl]oxy-5-methylcyclopentane-1-carboxylic acid (PubChem CID 153312960) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(diphenyl)silyl]oxy-5-methylcyclopentane-1-carboxylic acid.
| Compound Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-5-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 153312960 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-5-methylcyclopentane-1-carboxylic acid |
| SMILES | CC1CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1C(=O)O |
| InChI | InChI=1S/C23H30O3Si/c1-17-15-16-20(21(17)22(24)25)26-27(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20-21H,15-16H2,1-4H3,(H,24,25)/t17?,20-,21?/m1/s1 |
| InChIKey | NXKBPGHOLFFJMU-TWMPVWRBSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|