C22H27NO3Si — CID 102031533
(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid (PubChem CID 102031533) has the molecular formula C22H27NO3Si and a molecular weight of 381.55 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 102031533 |
| Molecular Formula | C22H27NO3Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](O[C@H]1C=CCN[C@@H]1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3Si/c1-22(2,3)27(17-11-6-4-7-12-17,18-13-8-5-9-14-18)26-19-15-10-16-23-20(19)21(24)25/h4-15,19-20,23H,16H2,1-3H3,(H,24,25)/t19-,20-/m0/s1 |
| InChIKey | XBCBUZONZGMYCI-PMACEKPBSA-N |
| XLogP | 2.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|