C21H26O2Si — CID 11739262
(1R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-ol (PubChem CID 11739262) has the molecular formula C21H26O2Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (1R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11739262 |
| Molecular Formula | C21H26O2Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (1R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1C=C[C@H](O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O2Si/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-18-15-14-17(22)16-18/h4-15,17-18,22H,16H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | PSWDQLNBZDLTBG-ROUUACIJSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|