C24H34O3Si — CID 11718250
(1S,2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-1,5-dimethylcyclohexane-1,2-diol (PubChem CID 11718250) has the molecular formula C24H34O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-1,5-dimethylcyclohexane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-1,5-dimethylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11718250 |
| Molecular Formula | C24H34O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1S,2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-1,5-dimethylcyclohexane-1,2-diol |
| SMILES | C[C@@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@](C)(O)C1 |
| InChI | InChI=1S/C24H34O3Si/c1-18-16-21(22(25)24(5,26)17-18)27-28(23(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18,21-22,25-26H,16-17H2,1-5H3/t18-,21+,22-,24+/m1/s1 |
| InChIKey | KRCNXUNNDHNCRG-QBTGUUFSSA-N |
| XLogP | 3.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|