C26H34O2Si — CID 11223498
tert-butyl-[(1S,2R,5S)-2-methyl-5-(2-methyloxiran-2-yl)cyclohex-3-en-1-yl]oxy-diphenylsilane (PubChem CID 11223498) has the molecular formula C26H34O2Si and a molecular weight of 406.64 g/mol. Its IUPAC name is tert-butyl-[(1S,2R,5S)-2-methyl-5-(2-methyloxiran-2-yl)cyclohex-3-en-1-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1S,2R,5S)-2-methyl-5-(2-methyloxiran-2-yl)cyclohex-3-en-1-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11223498 |
| Molecular Formula | C26H34O2Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | tert-butyl-[(1S,2R,5S)-2-methyl-5-(2-methyloxiran-2-yl)cyclohex-3-en-1-yl]oxy-diphenylsilane |
| SMILES | C[C@@H]1C=C[C@@H](C2(C)CO2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34O2Si/c1-20-16-17-21(26(5)19-27-26)18-24(20)28-29(25(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-17,20-21,24H,18-19H2,1-5H3/t20-,21-,24+,26?/m1/s1 |
| InChIKey | CQIGISOOESQUQL-JEUOTXNPSA-N |
| XLogP | 4.93 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|