C32H50O4Si2 — CID 11467037
(1S,2R,3S,4S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-6-(2-methyloxiran-2-yl)cyclohexan-1-ol (PubChem CID 11467037) has the molecular formula C32H50O4Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is (1S,2R,3S,4S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-6-(2-methyloxiran-2-yl)cyclohexan-1-ol.
| Compound Name | (1S,2R,3S,4S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-6-(2-methyloxiran-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11467037 |
| Molecular Formula | C32H50O4Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | (1S,2R,3S,4S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-6-(2-methyloxiran-2-yl)cyclohexan-1-ol |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C2(C)CO2)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50O4Si2/c1-23-27(21-26(32(8)22-34-32)28(33)29(23)36-37(9,10)30(2,3)4)35-38(31(5,6)7,24-17-13-11-14-18-24)25-19-15-12-16-20-25/h11-20,23,26-29,33H,21-22H2,1-10H3/t23-,26-,27-,28-,29+,32?/m0/s1 |
| InChIKey | PVEAGZLFPOYXNL-OOPIGHIZSA-N |
| XLogP | 6.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|