C23H32OSi — CID 158022147
tert-butyl-[(1R,2R)-2,4-dimethylcyclopentyl]oxy-diphenylsilane (PubChem CID 158022147) has the molecular formula C23H32OSi and a molecular weight of 352.59 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2,4-dimethylcyclopentyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2,4-dimethylcyclopentyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 158022147 |
| Molecular Formula | C23H32OSi |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl-[(1R,2R)-2,4-dimethylcyclopentyl]oxy-diphenylsilane |
| SMILES | CC1C[C@@H](C)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H32OSi/c1-18-16-19(2)22(17-18)24-25(23(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19,22H,16-17H2,1-5H3/t18?,19-,22-/m1/s1 |
| InChIKey | QUCORQMTHXPRML-IPNFRKERSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|