C22H31NOSi — CID 142751894
4-[tert-butyl(diphenyl)silyl]oxy-2-methylcyclopentan-1-amine (PubChem CID 142751894) has the molecular formula C22H31NOSi and a molecular weight of 353.58 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2-methylcyclopentan-1-amine.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 142751894 |
| Molecular Formula | C22H31NOSi |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-methylcyclopentan-1-amine |
| SMILES | CC1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1N |
| InChI | InChI=1S/C22H31NOSi/c1-17-15-18(16-21(17)23)24-25(22(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17-18,21H,15-16,23H2,1-4H3 |
| InChIKey | AUCREBGBLRWRLP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|