C22H32N2OSi — CID 177070919
(1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-diamine (PubChem CID 177070919) has the molecular formula C22H32N2OSi and a molecular weight of 368.60 g/mol. Its IUPAC name is (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-diamine.
| Compound Name | (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 177070919 |
| Molecular Formula | C22H32N2OSi |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (1S,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-diamine |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@H](N)[C@H](N)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32N2OSi/c1-22(2,3)26(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-17-14-15-20(23)21(24)16-17/h4-13,17,20-21H,14-16,23-24H2,1-3H3/t17-,20+,21-/m1/s1 |
| InChIKey | RIKAYCSKRZELKY-JRGCBEDISA-N |
| XLogP | 2.77 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|