C29H36O2Si — CID 142668206
1-[3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-phenylethanol (PubChem CID 142668206) has the molecular formula C29H36O2Si and a molecular weight of 444.69 g/mol. Its IUPAC name is 1-[3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-phenylethanol.
| Compound Name | 1-[3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-phenylethanol |
|---|---|
| PubChem CID | 142668206 |
| Molecular Formula | C29H36O2Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[3-[tert-butyl(diphenyl)silyl]oxycyclopentyl]-2-phenylethanol |
| SMILES | CC(C)(C)[Si](OC1CCC(C(O)Cc2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36O2Si/c1-29(2,3)32(26-15-9-5-10-16-26,27-17-11-6-12-18-27)31-25-20-19-24(22-25)28(30)21-23-13-7-4-8-14-23/h4-18,24-25,28,30H,19-22H2,1-3H3 |
| InChIKey | LDATVLRJIMMWFX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|