C24H31ClO2Si — CID 88611275
1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloroethanone (PubChem CID 88611275) has the molecular formula C24H31ClO2Si and a molecular weight of 415.05 g/mol. Its IUPAC name is 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloroethanone.
| Compound Name | 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloroethanone |
|---|---|
| PubChem CID | 88611275 |
| Molecular Formula | C24H31ClO2Si |
| Molecular Weight | 415.05 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloroethanone |
| SMILES | CC(C)(C)[Si](OC1CCC(C(=O)CCl)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31ClO2Si/c1-24(2,3)28(21-10-6-4-7-11-21,22-12-8-5-9-13-22)27-20-16-14-19(15-17-20)23(26)18-25/h4-13,19-20H,14-18H2,1-3H3 |
| InChIKey | XLAASRAACUCKBA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.05 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|