C29H40O5Si — CID 67213573
1-O-methyl 2-O-(2-methylpropyl) 4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate (PubChem CID 67213573) has the molecular formula C29H40O5Si and a molecular weight of 496.72 g/mol. Its IUPAC name is 1-O-methyl 2-O-(2-methylpropyl) 4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-methyl 2-O-(2-methylpropyl) 4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67213573 |
| Molecular Formula | C29H40O5Si |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 1-O-methyl 2-O-(2-methylpropyl) 4-[tert-butyl(diphenyl)silyl]oxycyclohexane-1,2-dicarboxylate |
| SMILES | COC(=O)C1CCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1C(=O)OCC(C)C |
| InChI | InChI=1S/C29H40O5Si/c1-21(2)20-33-28(31)26-19-22(17-18-25(26)27(30)32-6)34-35(29(3,4)5,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,21-22,25-26H,17-20H2,1-6H3 |
| InChIKey | AYBRUIQNWVVVII-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|