C24H32O4Si — CID 140825988
trans-methyl (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentane-1-carboxylate (PubChem CID 140825988) has the molecular formula C24H32O4Si and a molecular weight of 412.60 g/mol. Its IUPAC name is trans-methyl (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentane-1-carboxylate.
| Compound Name | trans-methyl (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 140825988 |
| Molecular Formula | C24H32O4Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | trans-methyl (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxycyclopentane-1-carboxylate |
| SMILES | COC(=O)C1C[C@@H](O)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O4Si/c1-24(2,3)29(20-11-7-5-8-12-20,21-13-9-6-10-14-21)28-17-18-15-19(25)16-22(18)23(26)27-4/h5-14,18-19,22,25H,15-17H2,1-4H3/t18-,19-,22?/m0/s1 |
| InChIKey | VBPOSAPJUAVXBW-NVPCEHRXSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|