C40H50O3Si2 — CID 101191463
(1S,2S,3R,5S,6R)-3,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[3.1.0]hexan-2-ol (PubChem CID 101191463) has the molecular formula C40H50O3Si2 and a molecular weight of 635.01 g/mol. Its IUPAC name is (1S,2S,3R,5S,6R)-3,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1S,2S,3R,5S,6R)-3,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 101191463 |
| Molecular Formula | C40H50O3Si2 |
| Molecular Weight | 635.01 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | (1S,2S,3R,5S,6R)-3,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[3.1.0]hexan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H50O3Si2/c1-39(2,3)44(31-19-11-7-12-20-31,32-21-13-8-14-22-32)42-28-30-27-35-36(37(35)38(30)41)29-43-45(40(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,30,35-38,41H,27-29H2,1-6H3/t30-,35+,36-,37+,38-/m1/s1 |
| InChIKey | AQKCIBKAZLNZMX-JLZVBNPWSA-N |
| XLogP | 6.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.01 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|