C35H38O2Si — CID 10369362
(1S,2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,2-diphenylethenyl)cyclobutan-1-ol (PubChem CID 10369362) has the molecular formula C35H38O2Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (1S,2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,2-diphenylethenyl)cyclobutan-1-ol.
| Compound Name | (1S,2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,2-diphenylethenyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 10369362 |
| Molecular Formula | C35H38O2Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (1S,2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2,2-diphenylethenyl)cyclobutan-1-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@H](O)[C@@H]1C=C(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O2Si/c1-35(2,3)38(30-20-12-6-13-21-30,31-22-14-7-15-23-31)37-26-29-24-34(36)33(29)25-32(27-16-8-4-9-17-27)28-18-10-5-11-19-28/h4-23,25,29,33-34,36H,24,26H2,1-3H3/t29-,33-,34+/m1/s1 |
| InChIKey | SAPIJPRNHLFCRW-SJZCYFJVSA-N |
| XLogP | 6.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|