C22H30O2SSi — CID 122207177
3-[[tert-butyl(diphenyl)silyl]oxymethyl]thian-4-ol (PubChem CID 122207177) has the molecular formula C22H30O2SSi and a molecular weight of 386.63 g/mol. Its IUPAC name is 3-[[tert-butyl(diphenyl)silyl]oxymethyl]thian-4-ol.
| Compound Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]thian-4-ol |
|---|---|
| PubChem CID | 122207177 |
| Molecular Formula | C22H30O2SSi |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]thian-4-ol |
| SMILES | CC(C)(C)[Si](OCC1CSCCC1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O2SSi/c1-22(2,3)26(19-10-6-4-7-11-19,20-12-8-5-9-13-20)24-16-18-17-25-15-14-21(18)23/h4-13,18,21,23H,14-17H2,1-3H3 |
| InChIKey | QUHPNEZQHJQIKC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|