C26H38O4Si — CID 71138268
4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxy]cyclopentane-1,2-diol (PubChem CID 71138268) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxy]cyclopentane-1,2-diol.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxy]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 71138268 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-methylpropan-2-yl)oxy]cyclopentane-1,2-diol |
| SMILES | CC(C)(C)OC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(O)C1O |
| InChI | InChI=1S/C26H38O4Si/c1-25(2,3)30-24-19(17-22(27)23(24)28)18-29-31(26(4,5)6,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-24,27-28H,17-18H2,1-6H3 |
| InChIKey | IHYQTULKOCCHGE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|