C23H32OSi — CID 123161962
tert-butyl-[(2-methylcyclopentyl)methoxy]-diphenylsilane (PubChem CID 123161962) has the molecular formula C23H32OSi and a molecular weight of 352.59 g/mol. Its IUPAC name is tert-butyl-[(2-methylcyclopentyl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2-methylcyclopentyl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 123161962 |
| Molecular Formula | C23H32OSi |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl-[(2-methylcyclopentyl)methoxy]-diphenylsilane |
| SMILES | CC1CCCC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32OSi/c1-19-12-11-13-20(19)18-24-25(23(2,3)4,21-14-7-5-8-15-21)22-16-9-6-10-17-22/h5-10,14-17,19-20H,11-13,18H2,1-4H3 |
| InChIKey | JLUGRVXHOICXSD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|