C25H37NOSi — CID 175638250
cis-(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,3-trimethylcyclopentan-1-amine (PubChem CID 175638250) has the molecular formula C25H37NOSi and a molecular weight of 395.66 g/mol. Its IUPAC name is cis-(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,3-trimethylcyclopentan-1-amine.
| Compound Name | cis-(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,3-trimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 175638250 |
| Molecular Formula | C25H37NOSi |
| Molecular Weight | 395.66 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | cis-(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,3-trimethylcyclopentan-1-amine |
| SMILES | C[C@@H]1CCC(N(C)C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37NOSi/c1-20-17-18-24(26(5)6)23(20)19-27-28(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24H,17-19H2,1-6H3/t20-,23+,24?/m1/s1 |
| InChIKey | ZQOWEJBBPQQVMF-FQCAPJHASA-N |
| XLogP | 4.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|