C31H44O2Si — CID 58193090
[(1S,2S,4aS,5S,8S,8aR)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanol (PubChem CID 58193090) has the molecular formula C31H44O2Si and a molecular weight of 476.78 g/mol. Its IUPAC name is [(1S,2S,4aS,5S,8S,8aR)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanol.
| Compound Name | [(1S,2S,4aS,5S,8S,8aR)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 58193090 |
| Molecular Formula | C31H44O2Si |
| Molecular Weight | 476.78 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | [(1S,2S,4aS,5S,8S,8aR)-1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]methanol |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]1CO)[C@@H](C)CC[C@@H]2C |
| InChI | InChI=1S/C31H44O2Si/c1-22-17-18-23(2)30-27(22)19-24(3)28(20-32)29(30)21-33-34(31(4,5)6,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-16,19,22-23,27-30,32H,17-18,20-21H2,1-6H3/t22-,23-,27-,28+,29+,30+/m0/s1 |
| InChIKey | VSYPZIVKCVOLSO-AWXAYHHUSA-N |
| XLogP | 6.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.78 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|