C24H34O4Si — CID 177392831
[(1R,2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxymethyl)cyclopropyl]methanol (PubChem CID 177392831) has the molecular formula C24H34O4Si and a molecular weight of 414.62 g/mol. Its IUPAC name is [(1R,2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxymethyl)cyclopropyl]methanol.
| Compound Name | [(1R,2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxymethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 177392831 |
| Molecular Formula | C24H34O4Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [(1R,2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxymethyl)cyclopropyl]methanol |
| SMILES | COCOC[C@H]1[C@@H](CO)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34O4Si/c1-24(2,3)29(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-17-23-21(15-25)22(23)16-27-18-26-4/h5-14,21-23,25H,15-18H2,1-4H3/t21-,22+,23+/m1/s1 |
| InChIKey | WELGYNMZZGPVLA-VJBWXMMDSA-N |
| XLogP | 3.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|