C24H36O6Si — CID 72793343
(2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-ol (PubChem CID 72793343) has the molecular formula C24H36O6Si and a molecular weight of 448.63 g/mol. Its IUPAC name is (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-ol.
| Compound Name | (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-ol |
|---|---|
| PubChem CID | 72793343 |
| Molecular Formula | C24H36O6Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-ol |
| SMILES | COCO[C@@H](CO)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C24H36O6Si/c1-24(2,3)31(20-12-8-6-9-13-20,21-14-10-7-11-15-21)30-17-23(29-19-27-5)22(16-25)28-18-26-4/h6-15,22-23,25H,16-19H2,1-5H3/t22-,23-/m0/s1 |
| InChIKey | APVPHSSJOGTNLJ-GOTSBHOMSA-N |
| XLogP | 2.53 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|