C25H38O4Si — CID 11796895
(6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)heptan-1-ol (PubChem CID 11796895) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)heptan-1-ol.
| Compound Name | (6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)heptan-1-ol |
|---|---|
| PubChem CID | 11796895 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (6R)-7-[tert-butyl(diphenyl)silyl]oxy-6-(methoxymethoxy)heptan-1-ol |
| SMILES | COCO[C@H](CCCCCO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H38O4Si/c1-25(2,3)30(23-15-9-5-10-16-23,24-17-11-6-12-18-24)29-20-22(28-21-27-4)14-8-7-13-19-26/h5-6,9-12,15-18,22,26H,7-8,13-14,19-21H2,1-4H3/t22-/m1/s1 |
| InChIKey | DQGPMGDLUGAUIG-JOCHJYFZSA-N |
| XLogP | 4.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|