C27H43NO2Si — CID 123627737
6-[tert-butyl(diphenyl)silyl]oxy-5-(3-methylbutylamino)hexan-1-ol (PubChem CID 123627737) has the molecular formula C27H43NO2Si and a molecular weight of 441.73 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-5-(3-methylbutylamino)hexan-1-ol.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-5-(3-methylbutylamino)hexan-1-ol |
|---|---|
| PubChem CID | 123627737 |
| Molecular Formula | C27H43NO2Si |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-5-(3-methylbutylamino)hexan-1-ol |
| SMILES | CC(C)CCNC(CCCCO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H43NO2Si/c1-23(2)19-20-28-24(14-12-13-21-29)22-30-31(27(3,4)5,25-15-8-6-9-16-25)26-17-10-7-11-18-26/h6-11,15-18,23-24,28-29H,12-14,19-22H2,1-5H3 |
| InChIKey | QMSUZPPAFRNXCK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|