C24H32O3Si — CID 10883802
8-[tert-butyl(diphenyl)silyl]oxyoct-6-yne-1,5-diol (PubChem CID 10883802) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]oxyoct-6-yne-1,5-diol.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]oxyoct-6-yne-1,5-diol |
|---|---|
| PubChem CID | 10883802 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]oxyoct-6-yne-1,5-diol |
| SMILES | CC(C)(C)[Si](OCC#CC(O)CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O3Si/c1-24(2,3)28(22-15-6-4-7-16-22,23-17-8-5-9-18-23)27-20-12-14-21(26)13-10-11-19-25/h4-9,15-18,21,25-26H,10-11,13,19-20H2,1-3H3 |
| InChIKey | CLJCMBAHYSHWTR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|