C42H50O3Si2 — CID 11125188
1,9-bis[[tert-butyl(diphenyl)silyl]oxy]deca-2,7-diyn-5-ol (PubChem CID 11125188) has the molecular formula C42H50O3Si2 and a molecular weight of 659.03 g/mol. Its IUPAC name is 1,9-bis[[tert-butyl(diphenyl)silyl]oxy]deca-2,7-diyn-5-ol.
| Compound Name | 1,9-bis[[tert-butyl(diphenyl)silyl]oxy]deca-2,7-diyn-5-ol |
|---|---|
| PubChem CID | 11125188 |
| Molecular Formula | C42H50O3Si2 |
| Molecular Weight | 659.03 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 1,9-bis[[tert-butyl(diphenyl)silyl]oxy]deca-2,7-diyn-5-ol |
| SMILES | CC(C#CCC(O)CC#CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H50O3Si2/c1-35(45-47(42(5,6)7,39-30-16-10-17-31-39)40-32-18-11-19-33-40)23-22-25-36(43)24-20-21-34-44-46(41(2,3)4,37-26-12-8-13-27-37)38-28-14-9-15-29-38/h8-19,26-33,35-36,43H,24-25,34H2,1-7H3 |
| InChIKey | RBDIZQJHUPIJAX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.03 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|