C21H27NOSi — CID 78163046
4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutanenitrile (PubChem CID 78163046) has the molecular formula C21H27NOSi and a molecular weight of 337.54 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutanenitrile.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutanenitrile |
|---|---|
| PubChem CID | 78163046 |
| Molecular Formula | C21H27NOSi |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-3-methylbutanenitrile |
| SMILES | CC(CC#N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H27NOSi/c1-18(15-16-22)17-23-24(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18H,15,17H2,1-4H3 |
| InChIKey | VEQRSALCUYZITO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|