C22H31BrOSi — CID 15282997
[(2R)-5-bromo-2-methylpentoxy]-tert-butyl-diphenylsilane (PubChem CID 15282997) has the molecular formula C22H31BrOSi and a molecular weight of 419.48 g/mol. Its IUPAC name is [(2R)-5-bromo-2-methylpentoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R)-5-bromo-2-methylpentoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15282997 |
| Molecular Formula | C22H31BrOSi |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [(2R)-5-bromo-2-methylpentoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@H](CCCBr)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H31BrOSi/c1-19(12-11-17-23)18-24-25(22(2,3)4,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,19H,11-12,17-18H2,1-4H3/t19-/m1/s1 |
| InChIKey | UCYANKZFXNHYQJ-LJQANCHMSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|