C24H34Br2OSi — CID 154420849
[(3S)-6-bromo-3-(2-bromoethyl)hexoxy]-tert-butyl-diphenylsilane (PubChem CID 154420849) has the molecular formula C24H34Br2OSi and a molecular weight of 526.43 g/mol. Its IUPAC name is [(3S)-6-bromo-3-(2-bromoethyl)hexoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(3S)-6-bromo-3-(2-bromoethyl)hexoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 154420849 |
| Molecular Formula | C24H34Br2OSi |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | [(3S)-6-bromo-3-(2-bromoethyl)hexoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC[C@@H](CCBr)CCCBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H34Br2OSi/c1-24(2,3)28(22-12-6-4-7-13-22,23-14-8-5-9-15-23)27-20-17-21(16-19-26)11-10-18-25/h4-9,12-15,21H,10-11,16-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | JVGLFSYQQITVLX-OAQYLSRUSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|