C22H30O2Si — CID 72966538
5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentanal (PubChem CID 72966538) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentanal.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentanal |
|---|---|
| PubChem CID | 72966538 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methylpentanal |
| SMILES | CC(C=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H30O2Si/c1-19(18-23)12-11-17-24-25(22(2,3)4,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,18-19H,11-12,17H2,1-4H3 |
| InChIKey | BBBMTZTZZSKZCF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|