C22H28O2Si — CID 10665724
5-[tert-butyl(diphenyl)silyl]oxy-2-methylidenepentanal (PubChem CID 10665724) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-2-methylidenepentanal.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methylidenepentanal |
|---|---|
| PubChem CID | 10665724 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methylidenepentanal |
| SMILES | C=C(C=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H28O2Si/c1-19(18-23)12-11-17-24-25(22(2,3)4,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,18H,1,11-12,17H2,2-4H3 |
| InChIKey | UCKGQWDUOPSLBA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|