C24H34O2Si — CID 174143208
(3S)-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-3-ol (PubChem CID 174143208) has the molecular formula C24H34O2Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (3S)-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-3-ol.
| Compound Name | (3S)-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-3-ol |
|---|---|
| PubChem CID | 174143208 |
| Molecular Formula | C24H34O2Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (3S)-8-[tert-butyl(diphenyl)silyl]oxyoct-1-en-3-ol |
| SMILES | C=C[C@@H](O)CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34O2Si/c1-5-21(25)15-9-8-14-20-26-27(24(2,3)4,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-7,10-13,16-19,21,25H,1,8-9,14-15,20H2,2-4H3/t21-/m1/s1 |
| InChIKey | YGLLFDAYINQFTR-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|