C23H32O2Si — CID 56971432
(3R,6R)-6-[tert-butyl(diphenyl)silyl]oxyhept-1-en-3-ol (PubChem CID 56971432) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (3R,6R)-6-[tert-butyl(diphenyl)silyl]oxyhept-1-en-3-ol.
| Compound Name | (3R,6R)-6-[tert-butyl(diphenyl)silyl]oxyhept-1-en-3-ol |
|---|---|
| PubChem CID | 56971432 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3R,6R)-6-[tert-butyl(diphenyl)silyl]oxyhept-1-en-3-ol |
| SMILES | C=C[C@H](O)CC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O2Si/c1-6-20(24)18-17-19(2)25-26(23(3,4)5,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h6-16,19-20,24H,1,17-18H2,2-5H3/t19-,20+/m1/s1 |
| InChIKey | YBUCJJTZIRUHPV-UXHICEINSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|