C25H36O2Si — CID 10992951
(2S,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-ol (PubChem CID 10992951) has the molecular formula C25H36O2Si and a molecular weight of 396.65 g/mol. Its IUPAC name is (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-ol.
| Compound Name | (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-ol |
|---|---|
| PubChem CID | 10992951 |
| Molecular Formula | C25H36O2Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (2S,4R)-2-[tert-butyl(diphenyl)silyl]oxynon-8-en-4-ol |
| SMILES | C=CCCC[C@@H](O)C[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O2Si/c1-6-7-10-15-22(26)20-21(2)27-28(25(3,4)5,23-16-11-8-12-17-23)24-18-13-9-14-19-24/h6,8-9,11-14,16-19,21-22,26H,1,7,10,15,20H2,2-5H3/t21-,22+/m0/s1 |
| InChIKey | KLNVHBPQTIEPHE-FCHUYYIVSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|