C27H40OSi — CID 11988597
tert-butyl-diphenyl-[(2S)-undec-10-en-2-yl]oxysilane (PubChem CID 11988597) has the molecular formula C27H40OSi and a molecular weight of 408.70 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2S)-undec-10-en-2-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(2S)-undec-10-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 11988597 |
| Molecular Formula | C27H40OSi |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | tert-butyl-diphenyl-[(2S)-undec-10-en-2-yl]oxysilane |
| SMILES | C=CCCCCCCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40OSi/c1-6-7-8-9-10-11-14-19-24(2)28-29(27(3,4)5,25-20-15-12-16-21-25)26-22-17-13-18-23-26/h6,12-13,15-18,20-24H,1,7-11,14,19H2,2-5H3/t24-/m0/s1 |
| InChIKey | IRAZAHVQMOCISW-DEOSSOPVSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|